C9H18BrN — CID 25198143
(2R,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine (PubChem CID 25198143) has the molecular formula C9H18BrN and a molecular weight of 220.15 g/mol. Its IUPAC name is (2R,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine.
| Compound Name | (2R,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 25198143 |
| Molecular Formula | C9H18BrN |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (2R,3R)-3-bromo-2,3-dimethyl-1-propan-2-ylpyrrolidine |
| SMILES | CC(C)N1CC[C@@](C)(Br)[C@H]1C |
| InChI | InChI=1S/C9H18BrN/c1-7(2)11-6-5-9(4,10)8(11)3/h7-8H,5-6H2,1-4H3/t8-,9-/m1/s1 |
| InChIKey | GBCUGQPGSCKRPR-RKDXNWHRSA-N |
| XLogP | 2.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|