C16H26O2 — CID 25199156
1-[(2R,3R,3aS,7aS)-3-ethenyl-3-hydroxy-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-2-yl]ethanone (PubChem CID 25199156) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-[(2R,3R,3aS,7aS)-3-ethenyl-3-hydroxy-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-2-yl]ethanone.
| Compound Name | 1-[(2R,3R,3aS,7aS)-3-ethenyl-3-hydroxy-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-2-yl]ethanone |
|---|---|
| PubChem CID | 25199156 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-[(2R,3R,3aS,7aS)-3-ethenyl-3-hydroxy-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-2-yl]ethanone |
| SMILES | C=C[C@@]1(O)[C@H](C(C)=O)C[C@H]2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C16H26O2/c1-6-16(18)12(11(2)17)10-13-14(3,4)8-7-9-15(13,16)5/h6,12-13,18H,1,7-10H2,2-5H3/t12-,13-,15-,16+/m0/s1 |
| InChIKey | XBQSMWYIYVZSOU-DARAHFNDSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|