C24H24N2O5S — CID 25204715
4-(1-benzoylpiperidin-4-yl)oxy-1-(4-methylsulfonylphenyl)pyridin-2-one (PubChem CID 25204715) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is 4-(1-benzoylpiperidin-4-yl)oxy-1-(4-methylsulfonylphenyl)pyridin-2-one.
| Compound Name | 4-(1-benzoylpiperidin-4-yl)oxy-1-(4-methylsulfonylphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 25204715 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-(1-benzoylpiperidin-4-yl)oxy-1-(4-methylsulfonylphenyl)pyridin-2-one |
| SMILES | CS(=O)(=O)c1ccc(-n2ccc(OC3CCN(C(=O)c4ccccc4)CC3)cc2=O)cc1 |
| InChI | InChI=1S/C24H24N2O5S/c1-32(29,30)22-9-7-19(8-10-22)26-16-13-21(17-23(26)27)31-20-11-14-25(15-12-20)24(28)18-5-3-2-4-6-18/h2-10,13,16-17,20H,11-12,14-15H2,1H3 |
| InChIKey | RBVPUXMBUYIDSR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |