C20H23NO5S — CID 58458108
4-(4-acetylcyclohexyl)oxy-1-(4-methylsulfonylphenyl)pyridin-2-one (PubChem CID 58458108) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 4-(4-acetylcyclohexyl)oxy-1-(4-methylsulfonylphenyl)pyridin-2-one.
| Compound Name | 4-(4-acetylcyclohexyl)oxy-1-(4-methylsulfonylphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 58458108 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-(4-acetylcyclohexyl)oxy-1-(4-methylsulfonylphenyl)pyridin-2-one |
| SMILES | CC(=O)C1CCC(Oc2ccn(-c3ccc(S(C)(=O)=O)cc3)c(=O)c2)CC1 |
| InChI | InChI=1S/C20H23NO5S/c1-14(22)15-3-7-17(8-4-15)26-18-11-12-21(20(23)13-18)16-5-9-19(10-6-16)27(2,24)25/h5-6,9-13,15,17H,3-4,7-8H2,1-2H3 |
| InChIKey | HRUHEFKKDVYQBR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |