C11H8F7NO3S — CID 25206229
2-fluoro-2-(3,4,5-trifluorophenyl)-2-(3,3,3-trifluoropropylsulfonyl)acetamide (PubChem CID 25206229) has the molecular formula C11H8F7NO3S and a molecular weight of 367.24 g/mol. Its IUPAC name is 2-fluoro-2-(3,4,5-trifluorophenyl)-2-(3,3,3-trifluoropropylsulfonyl)acetamide.
| Compound Name | 2-fluoro-2-(3,4,5-trifluorophenyl)-2-(3,3,3-trifluoropropylsulfonyl)acetamide |
|---|---|
| PubChem CID | 25206229 |
| Molecular Formula | C11H8F7NO3S |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 2-fluoro-2-(3,4,5-trifluorophenyl)-2-(3,3,3-trifluoropropylsulfonyl)acetamide |
| SMILES | NC(=O)C(F)(c1cc(F)c(F)c(F)c1)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H8F7NO3S/c12-6-3-5(4-7(13)8(6)14)11(18,9(19)20)23(21,22)2-1-10(15,16)17/h3-4H,1-2H2,(H2,19,20) |
| InChIKey | TVLZVGRXWCGNDN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|