C33H40N2O3 — CID 25206919
7-(5-cyclohexylpent-1-ynyl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2,3,4,5-tetrahydro-1-benzoxepine-9-carboxamide (PubChem CID 25206919) has the molecular formula C33H40N2O3 and a molecular weight of 512.69 g/mol. Its IUPAC name is 7-(5-cyclohexylpent-1-ynyl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2,3,4,5-tetrahydro-1-benzoxepine-9-carboxamide.
| Compound Name | 7-(5-cyclohexylpent-1-ynyl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2,3,4,5-tetrahydro-1-benzoxepine-9-carboxamide |
|---|---|
| PubChem CID | 25206919 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 7-(5-cyclohexylpent-1-ynyl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2,3,4,5-tetrahydro-1-benzoxepine-9-carboxamide |
| SMILES | O=C(N[C@@H](CO)Cc1c[nH]c2ccccc12)c1cc(C#CCCCC2CCCCC2)cc2c1OCCCC2 |
| InChI | InChI=1S/C33H40N2O3/c36-23-28(21-27-22-34-31-17-8-7-16-29(27)31)35-33(37)30-20-25(19-26-15-9-10-18-38-32(26)30)14-6-2-5-13-24-11-3-1-4-12-24/h7-8,16-17,19-20,22,24,28,34,36H,1-5,9-13,15,18,21,23H2,(H,35,37)/t28-/m1/s1 |
| InChIKey | BSDKIPONDZJZRD-MUUNZHRXSA-N |
| XLogP | 6.32 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|