C25H30N2O4 — CID 143749618
4-(9-aminooxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl)but-3-yn-1-ol;3-(1H-indol-3-yl)propan-1-ol (PubChem CID 143749618) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-(9-aminooxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl)but-3-yn-1-ol;3-(1H-indol-3-yl)propan-1-ol.
| Compound Name | 4-(9-aminooxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl)but-3-yn-1-ol;3-(1H-indol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 143749618 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-(9-aminooxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl)but-3-yn-1-ol;3-(1H-indol-3-yl)propan-1-ol |
| SMILES | NOc1cc(C#CCCO)cc2c1OCCCC2.OCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H17NO3.C11H13NO/c15-18-13-10-11(5-1-3-7-16)9-12-6-2-4-8-17-14(12)13;13-7-3-4-9-8-12-11-6-2-1-5-10(9)11/h9-10,16H,2-4,6-8,15H2;1-2,5-6,8,12-13H,3-4,7H2 |
| InChIKey | ZHGSLKKZDKRHRA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|