C34H37NO3 — CID 25207865
(2R,3R,4R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine (PubChem CID 25207865) has the molecular formula C34H37NO3 and a molecular weight of 507.67 g/mol. Its IUPAC name is (2R,3R,4R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine.
| Compound Name | (2R,3R,4R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 25207865 |
| Molecular Formula | C34H37NO3 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (2R,3R,4R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
| SMILES | c1ccc(COC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)CCN2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H37NO3/c1-5-13-28(14-6-1)23-35-22-21-33(37-25-30-17-9-3-10-18-30)34(38-26-31-19-11-4-12-20-31)32(35)27-36-24-29-15-7-2-8-16-29/h1-20,32-34H,21-27H2/t32-,33-,34-/m1/s1 |
| InChIKey | RSWSJAQDYYKURC-CKOYEXALSA-N |
| XLogP | 6.65 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |