C16H14ClN3O3 — CID 25208084
1-[(4-chlorophenyl)methyl]-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole (PubChem CID 25208084) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 25208084 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole |
| SMILES | O=[N+]([O-])/C(=C\c1ccco1)C1=NCCN1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClN3O3/c17-13-5-3-12(4-6-13)11-19-8-7-18-16(19)15(20(21)22)10-14-2-1-9-23-14/h1-6,9-10H,7-8,11H2/b15-10- |
| InChIKey | GFOJDFLEIZKNIZ-GDNBJRDFSA-N |
| XLogP | 3.46 |
| TPSA | 71.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|