C12H10ClF3O2 — CID 25208468
[2-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-4-methylphenyl] acetate (PubChem CID 25208468) has the molecular formula C12H10ClF3O2 and a molecular weight of 278.66 g/mol. Its IUPAC name is [2-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-4-methylphenyl] acetate.
| Compound Name | [2-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-4-methylphenyl] acetate |
|---|---|
| PubChem CID | 25208468 |
| Molecular Formula | C12H10ClF3O2 |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | [2-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-4-methylphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C)cc1/C=C(\Cl)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF3O2/c1-7-3-4-10(18-8(2)17)9(5-7)6-11(13)12(14,15)16/h3-6H,1-2H3/b11-6- |
| InChIKey | FWLAUJIGXQBJEJ-WDZFZDKYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|