C11H7BrClF3O2 — CID 74429811
[4-bromo-2-(2-chloro-3,3,3-trifluoroprop-1-enyl)phenyl] acetate (PubChem CID 74429811) has the molecular formula C11H7BrClF3O2 and a molecular weight of 343.53 g/mol. Its IUPAC name is [4-bromo-2-(2-chloro-3,3,3-trifluoroprop-1-enyl)phenyl] acetate.
| Compound Name | [4-bromo-2-(2-chloro-3,3,3-trifluoroprop-1-enyl)phenyl] acetate |
|---|---|
| PubChem CID | 74429811 |
| Molecular Formula | C11H7BrClF3O2 |
| Molecular Weight | 343.53 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | [4-bromo-2-(2-chloro-3,3,3-trifluoroprop-1-enyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Br)cc1C=C(Cl)C(F)(F)F |
| InChI | InChI=1S/C11H7BrClF3O2/c1-6(17)18-9-3-2-8(12)4-7(9)5-10(13)11(14,15)16/h2-5H,1H3 |
| InChIKey | UJSQNXVLEFDYIP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|