C18H24N4O4 — CID 25211116
ethyl 5-(benzylcarbamoylamino)-1-(2-hydroxybutyl)pyrazole-4-carboxylate (PubChem CID 25211116) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl 5-(benzylcarbamoylamino)-1-(2-hydroxybutyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(benzylcarbamoylamino)-1-(2-hydroxybutyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 25211116 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl 5-(benzylcarbamoylamino)-1-(2-hydroxybutyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CC(O)CC)c1NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H24N4O4/c1-3-14(23)12-22-16(15(11-20-22)17(24)26-4-2)21-18(25)19-10-13-8-6-5-7-9-13/h5-9,11,14,23H,3-4,10,12H2,1-2H3,(H2,19,21,25) |
| InChIKey | DDJIEBZFVCZGAF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |