C17H21FN4O4 — CID 25211122
ethyl 5-[(2-fluorophenyl)carbamoylamino]-1-(2-hydroxybutyl)pyrazole-4-carboxylate (PubChem CID 25211122) has the molecular formula C17H21FN4O4 and a molecular weight of 364.38 g/mol. Its IUPAC name is ethyl 5-[(2-fluorophenyl)carbamoylamino]-1-(2-hydroxybutyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2-fluorophenyl)carbamoylamino]-1-(2-hydroxybutyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 25211122 |
| Molecular Formula | C17H21FN4O4 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | ethyl 5-[(2-fluorophenyl)carbamoylamino]-1-(2-hydroxybutyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CC(O)CC)c1NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C17H21FN4O4/c1-3-11(23)10-22-15(12(9-19-22)16(24)26-4-2)21-17(25)20-14-8-6-5-7-13(14)18/h5-9,11,23H,3-4,10H2,1-2H3,(H2,20,21,25) |
| InChIKey | KUKYHHAKWBMRNG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |