C19H26N4O5 — CID 16749230
ethyl 5-(2-ethoxyethylcarbamoylamino)-1-(2-hydroxy-2-phenylethyl)pyrazole-4-carboxylate (PubChem CID 16749230) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl 5-(2-ethoxyethylcarbamoylamino)-1-(2-hydroxy-2-phenylethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(2-ethoxyethylcarbamoylamino)-1-(2-hydroxy-2-phenylethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 16749230 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | ethyl 5-(2-ethoxyethylcarbamoylamino)-1-(2-hydroxy-2-phenylethyl)pyrazole-4-carboxylate |
| SMILES | CCOCCNC(=O)Nc1c(C(=O)OCC)cnn1CC(O)c1ccccc1 |
| InChI | InChI=1S/C19H26N4O5/c1-3-27-11-10-20-19(26)22-17-15(18(25)28-4-2)12-21-23(17)13-16(24)14-8-6-5-7-9-14/h5-9,12,16,24H,3-4,10-11,13H2,1-2H3,(H2,20,22,26) |
| InChIKey | BUXUTSZDUKMQBP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|