C21H20FN3O4 — CID 164510725
ethyl 5-[(3-fluorobenzoyl)amino]-1-(2-hydroxy-2-phenylethyl)pyrazole-4-carboxylate (PubChem CID 164510725) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is ethyl 5-[(3-fluorobenzoyl)amino]-1-(2-hydroxy-2-phenylethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(3-fluorobenzoyl)amino]-1-(2-hydroxy-2-phenylethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 164510725 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | ethyl 5-[(3-fluorobenzoyl)amino]-1-(2-hydroxy-2-phenylethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CC(O)c2ccccc2)c1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H20FN3O4/c1-2-29-21(28)17-12-23-25(13-18(26)14-7-4-3-5-8-14)19(17)24-20(27)15-9-6-10-16(22)11-15/h3-12,18,26H,2,13H2,1H3,(H,24,27) |
| InChIKey | RYOPGLQWGWYEDE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |