C19H21N3O — CID 25213245
5-methyl-N-(oxan-4-yl)-2-pyridin-2-yl-1H-indol-7-amine (PubChem CID 25213245) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 5-methyl-N-(oxan-4-yl)-2-pyridin-2-yl-1H-indol-7-amine.
| Compound Name | 5-methyl-N-(oxan-4-yl)-2-pyridin-2-yl-1H-indol-7-amine |
|---|---|
| PubChem CID | 25213245 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 5-methyl-N-(oxan-4-yl)-2-pyridin-2-yl-1H-indol-7-amine |
| SMILES | Cc1cc(NC2CCOCC2)c2[nH]c(-c3ccccn3)cc2c1 |
| InChI | InChI=1S/C19H21N3O/c1-13-10-14-12-17(16-4-2-3-7-20-16)22-19(14)18(11-13)21-15-5-8-23-9-6-15/h2-4,7,10-12,15,21-22H,5-6,8-9H2,1H3 |
| InChIKey | YEJCDFXPCOUGFF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |