C19H19ClN2 — CID 25214710
5-chloro-N-cyclopentyl-2-phenyl-1H-indol-7-amine (PubChem CID 25214710) has the molecular formula C19H19ClN2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 5-chloro-N-cyclopentyl-2-phenyl-1H-indol-7-amine.
| Compound Name | 5-chloro-N-cyclopentyl-2-phenyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 25214710 |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-chloro-N-cyclopentyl-2-phenyl-1H-indol-7-amine |
| SMILES | Clc1cc(NC2CCCC2)c2[nH]c(-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C19H19ClN2/c20-15-10-14-11-17(13-6-2-1-3-7-13)22-19(14)18(12-15)21-16-8-4-5-9-16/h1-3,6-7,10-12,16,21-22H,4-5,8-9H2 |
| InChIKey | VKQCQQGSHHJRBG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |