C21H21ClN2O2 — CID 174613965
3-[[5-chloro-7-(cyclopentylamino)-1H-indol-2-yl]methyl]benzoic acid (PubChem CID 174613965) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 3-[[5-chloro-7-(cyclopentylamino)-1H-indol-2-yl]methyl]benzoic acid.
| Compound Name | 3-[[5-chloro-7-(cyclopentylamino)-1H-indol-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 174613965 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-[[5-chloro-7-(cyclopentylamino)-1H-indol-2-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cc2cc3cc(Cl)cc(NC4CCCC4)c3[nH]2)c1 |
| InChI | InChI=1S/C21H21ClN2O2/c22-16-10-15-11-18(9-13-4-3-5-14(8-13)21(25)26)24-20(15)19(12-16)23-17-6-1-2-7-17/h3-5,8,10-12,17,23-24H,1-2,6-7,9H2,(H,25,26) |
| InChIKey | CYXOMDNJMDLSGV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |