C25H29ClN4O — CID 174608532
4-[[5-chloro-7-(cyclopentylamino)-2-phenyl-1H-indol-3-yl]methyl]piperazine-2-carbaldehyde (PubChem CID 174608532) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is 4-[[5-chloro-7-(cyclopentylamino)-2-phenyl-1H-indol-3-yl]methyl]piperazine-2-carbaldehyde.
| Compound Name | 4-[[5-chloro-7-(cyclopentylamino)-2-phenyl-1H-indol-3-yl]methyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174608532 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-[[5-chloro-7-(cyclopentylamino)-2-phenyl-1H-indol-3-yl]methyl]piperazine-2-carbaldehyde |
| SMILES | O=CC1CN(Cc2c(-c3ccccc3)[nH]c3c(NC4CCCC4)cc(Cl)cc23)CCN1 |
| InChI | InChI=1S/C25H29ClN4O/c26-18-12-21-22(15-30-11-10-27-20(14-30)16-31)24(17-6-2-1-3-7-17)29-25(21)23(13-18)28-19-8-4-5-9-19/h1-3,6-7,12-13,16,19-20,27-29H,4-5,8-11,14-15H2 |
| InChIKey | ZMRVAZNNGGSHPJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|