C22H27N3 — CID 68812331
N-(1-benzylpiperidin-4-yl)-2,3-dimethyl-1H-indol-7-amine (PubChem CID 68812331) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2,3-dimethyl-1H-indol-7-amine.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2,3-dimethyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 68812331 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2,3-dimethyl-1H-indol-7-amine |
| SMILES | Cc1[nH]c2c(NC3CCN(Cc4ccccc4)CC3)cccc2c1C |
| InChI | InChI=1S/C22H27N3/c1-16-17(2)23-22-20(16)9-6-10-21(22)24-19-11-13-25(14-12-19)15-18-7-4-3-5-8-18/h3-10,19,23-24H,11-15H2,1-2H3 |
| InChIKey | ZGAMNEGOOSBZNP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|