C21H27ClN2O — CID 3587375
N-(3-chloro-2-methylphenyl)-1-[(4-ethoxyphenyl)methyl]piperidin-4-amine (PubChem CID 3587375) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-1-[(4-ethoxyphenyl)methyl]piperidin-4-amine.
| Compound Name | N-(3-chloro-2-methylphenyl)-1-[(4-ethoxyphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 3587375 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-1-[(4-ethoxyphenyl)methyl]piperidin-4-amine |
| SMILES | CCOc1ccc(CN2CCC(Nc3cccc(Cl)c3C)CC2)cc1 |
| InChI | InChI=1S/C21H27ClN2O/c1-3-25-19-9-7-17(8-10-19)15-24-13-11-18(12-14-24)23-21-6-4-5-20(22)16(21)2/h4-10,18,23H,3,11-15H2,1-2H3 |
| InChIKey | IWZHIZKFTZVRKW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |