C25H30ClN3O2 — CID 67401361
8-chloro-N-[1-[(3,5-diethoxyphenyl)methyl]piperidin-4-yl]quinolin-2-amine (PubChem CID 67401361) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is 8-chloro-N-[1-[(3,5-diethoxyphenyl)methyl]piperidin-4-yl]quinolin-2-amine.
| Compound Name | 8-chloro-N-[1-[(3,5-diethoxyphenyl)methyl]piperidin-4-yl]quinolin-2-amine |
|---|---|
| PubChem CID | 67401361 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 8-chloro-N-[1-[(3,5-diethoxyphenyl)methyl]piperidin-4-yl]quinolin-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ccc4cccc(Cl)c4n3)CC2)cc(OCC)c1 |
| InChI | InChI=1S/C25H30ClN3O2/c1-3-30-21-14-18(15-22(16-21)31-4-2)17-29-12-10-20(11-13-29)27-24-9-8-19-6-5-7-23(26)25(19)28-24/h5-9,14-16,20H,3-4,10-13,17H2,1-2H3,(H,27,28) |
| InChIKey | BDSXHEHZNXDMJM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |