C25H28ClN3O2 — CID 67402123
8-chloro-N-[1-[(4-methoxy-3-prop-2-enoxyphenyl)methyl]piperidin-4-yl]quinolin-2-amine (PubChem CID 67402123) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is 8-chloro-N-[1-[(4-methoxy-3-prop-2-enoxyphenyl)methyl]piperidin-4-yl]quinolin-2-amine.
| Compound Name | 8-chloro-N-[1-[(4-methoxy-3-prop-2-enoxyphenyl)methyl]piperidin-4-yl]quinolin-2-amine |
|---|---|
| PubChem CID | 67402123 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 8-chloro-N-[1-[(4-methoxy-3-prop-2-enoxyphenyl)methyl]piperidin-4-yl]quinolin-2-amine |
| SMILES | C=CCOc1cc(CN2CCC(Nc3ccc4cccc(Cl)c4n3)CC2)ccc1OC |
| InChI | InChI=1S/C25H28ClN3O2/c1-3-15-31-23-16-18(7-9-22(23)30-2)17-29-13-11-20(12-14-29)27-24-10-8-19-5-4-6-21(26)25(19)28-24/h3-10,16,20H,1,11-15,17H2,2H3,(H,27,28) |
| InChIKey | FBRVMOFXDJJSCT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|