C23H27N3O6 — CID 66912330
[2-[[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]amino]-1,3-benzoxazol-4-yl] hydrogen carbonate (PubChem CID 66912330) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is [2-[[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]amino]-1,3-benzoxazol-4-yl] hydrogen carbonate.
| Compound Name | [2-[[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]amino]-1,3-benzoxazol-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 66912330 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [2-[[1-[(3-ethoxy-4-methoxyphenyl)methyl]piperidin-4-yl]amino]-1,3-benzoxazol-4-yl] hydrogen carbonate |
| SMILES | CCOc1cc(CN2CCC(Nc3nc4c(OC(=O)O)cccc4o3)CC2)ccc1OC |
| InChI | InChI=1S/C23H27N3O6/c1-3-30-20-13-15(7-8-17(20)29-2)14-26-11-9-16(10-12-26)24-22-25-21-18(31-22)5-4-6-19(21)32-23(27)28/h4-8,13,16H,3,9-12,14H2,1-2H3,(H,24,25)(H,27,28) |
| InChIKey | ONJFPUZTUIOBEU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|