C28H32N4O6 — CID 66912344
[2-[[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]amino]-1,3-benzoxazol-4-yl] hydrogen carbonate (PubChem CID 66912344) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is [2-[[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]amino]-1,3-benzoxazol-4-yl] hydrogen carbonate.
| Compound Name | [2-[[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]amino]-1,3-benzoxazol-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 66912344 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | [2-[[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]amino]-1,3-benzoxazol-4-yl] hydrogen carbonate |
| SMILES | CCOc1cc(CN2CCC(Nc3nc4c(OC(=O)O)cccc4o3)CC2)cc(OCC)c1-n1cccc1 |
| InChI | InChI=1S/C28H32N4O6/c1-3-35-23-16-19(17-24(36-4-2)26(23)32-12-5-6-13-32)18-31-14-10-20(11-15-31)29-27-30-25-21(37-27)8-7-9-22(25)38-28(33)34/h5-9,12-13,16-17,20H,3-4,10-11,14-15,18H2,1-2H3,(H,29,30)(H,33,34) |
| InChIKey | SDNLSNJGVDKGRW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|