C27H31N5O5 — CID 66912138
N-[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]-4-nitro-1,3-benzoxazol-2-amine (PubChem CID 66912138) has the molecular formula C27H31N5O5 and a molecular weight of 505.58 g/mol. Its IUPAC name is N-[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]-4-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]-4-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 66912138 |
| Molecular Formula | C27H31N5O5 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | N-[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]-4-nitro-1,3-benzoxazol-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3nc4c([N+](=O)[O-])cccc4o3)CC2)cc(OCC)c1-n1cccc1 |
| InChI | InChI=1S/C27H31N5O5/c1-3-35-23-16-19(17-24(36-4-2)26(23)31-12-5-6-13-31)18-30-14-10-20(11-15-30)28-27-29-25-21(32(33)34)8-7-9-22(25)37-27/h5-9,12-13,16-17,20H,3-4,10-11,14-15,18H2,1-2H3,(H,28,29) |
| InChIKey | KPXGNKJTBAGMKO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|