C27H33N5O3 — CID 69250718
2-N-[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]-1,3-benzoxazole-2,5-diamine (PubChem CID 69250718) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-N-[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 69250718 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 2-N-[1-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]-1,3-benzoxazole-2,5-diamine |
| SMILES | CCOc1cc(CN2CCC(Nc3nc4cc(N)ccc4o3)CC2)cc(OCC)c1-n1cccc1 |
| InChI | InChI=1S/C27H33N5O3/c1-3-33-24-15-19(16-25(34-4-2)26(24)32-11-5-6-12-32)18-31-13-9-21(10-14-31)29-27-30-22-17-20(28)7-8-23(22)35-27/h5-8,11-12,15-17,21H,3-4,9-10,13-14,18,28H2,1-2H3,(H,29,30) |
| InChIKey | MLIQCHNAUNPSCZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|