C24H28FN3O6 — CID 87201781
[2-[[1-[[3-(2-fluoroethoxy)-4-methoxyphenyl]methyl]piperidin-4-yl]amino]-1,3-benzoxazol-6-yl] methyl carbonate (PubChem CID 87201781) has the molecular formula C24H28FN3O6 and a molecular weight of 473.50 g/mol. Its IUPAC name is [2-[[1-[[3-(2-fluoroethoxy)-4-methoxyphenyl]methyl]piperidin-4-yl]amino]-1,3-benzoxazol-6-yl] methyl carbonate.
| Compound Name | [2-[[1-[[3-(2-fluoroethoxy)-4-methoxyphenyl]methyl]piperidin-4-yl]amino]-1,3-benzoxazol-6-yl] methyl carbonate |
|---|---|
| PubChem CID | 87201781 |
| Molecular Formula | C24H28FN3O6 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [2-[[1-[[3-(2-fluoroethoxy)-4-methoxyphenyl]methyl]piperidin-4-yl]amino]-1,3-benzoxazol-6-yl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc2nc(NC3CCN(Cc4ccc(OC)c(OCCF)c4)CC3)oc2c1 |
| InChI | InChI=1S/C24H28FN3O6/c1-30-20-6-3-16(13-22(20)32-12-9-25)15-28-10-7-17(8-11-28)26-23-27-19-5-4-18(14-21(19)34-23)33-24(29)31-2/h3-6,13-14,17H,7-12,15H2,1-2H3,(H,26,27) |
| InChIKey | LNBKZEBMAWJTDU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|