C15H16ClN3O2 — CID 154249318
4-[(8-chloroquinolin-2-yl)amino]piperidine-1-carboxylic acid (PubChem CID 154249318) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is 4-[(8-chloroquinolin-2-yl)amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[(8-chloroquinolin-2-yl)amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154249318 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[(8-chloroquinolin-2-yl)amino]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(Nc2ccc3cccc(Cl)c3n2)CC1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-12-3-1-2-10-4-5-13(18-14(10)12)17-11-6-8-19(9-7-11)15(20)21/h1-5,11H,6-9H2,(H,17,18)(H,20,21) |
| InChIKey | MNEYJJWBMBFVIL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |