C19H17BrClN3O2 — CID 133436512
[4-[(6-bromo-8-chloroquinolin-2-yl)amino]piperidin-1-yl]-(furan-3-yl)methanone (PubChem CID 133436512) has the molecular formula C19H17BrClN3O2 and a molecular weight of 434.72 g/mol. Its IUPAC name is [4-[(6-bromo-8-chloroquinolin-2-yl)amino]piperidin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-[(6-bromo-8-chloroquinolin-2-yl)amino]piperidin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 133436512 |
| Molecular Formula | C19H17BrClN3O2 |
| Molecular Weight | 434.72 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | [4-[(6-bromo-8-chloroquinolin-2-yl)amino]piperidin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCC(Nc2ccc3cc(Br)cc(Cl)c3n2)CC1 |
| InChI | InChI=1S/C19H17BrClN3O2/c20-14-9-12-1-2-17(23-18(12)16(21)10-14)22-15-3-6-24(7-4-15)19(25)13-5-8-26-11-13/h1-2,5,8-11,15H,3-4,6-7H2,(H,22,23) |
| InChIKey | KIIYZDRPTPEFQQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |