C18H17BrN4O2S — CID 167769071
[4-[[6-(5-bromothiophen-2-yl)pyridazin-3-yl]amino]piperidin-1-yl]-(furan-3-yl)methanone (PubChem CID 167769071) has the molecular formula C18H17BrN4O2S and a molecular weight of 433.33 g/mol. Its IUPAC name is [4-[[6-(5-bromothiophen-2-yl)pyridazin-3-yl]amino]piperidin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-[[6-(5-bromothiophen-2-yl)pyridazin-3-yl]amino]piperidin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 167769071 |
| Molecular Formula | C18H17BrN4O2S |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | [4-[[6-(5-bromothiophen-2-yl)pyridazin-3-yl]amino]piperidin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCC(Nc2ccc(-c3ccc(Br)s3)nn2)CC1 |
| InChI | InChI=1S/C18H17BrN4O2S/c19-16-3-2-15(26-16)14-1-4-17(22-21-14)20-13-5-8-23(9-6-13)18(24)12-7-10-25-11-12/h1-4,7,10-11,13H,5-6,8-9H2,(H,20,22) |
| InChIKey | DCOSKLPANGMIHY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |