C20H22ClF3N2 — CID 3931119
N-(3-chloro-2-methylphenyl)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-amine (PubChem CID 3931119) has the molecular formula C20H22ClF3N2 and a molecular weight of 382.86 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | N-(3-chloro-2-methylphenyl)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 3931119 |
| Molecular Formula | C20H22ClF3N2 |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
| SMILES | Cc1c(Cl)cccc1NC1CCN(Cc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H22ClF3N2/c1-14-18(21)7-4-8-19(14)25-16-9-11-26(12-10-16)13-15-5-2-3-6-17(15)20(22,23)24/h2-8,16,25H,9-13H2,1H3 |
| InChIKey | QWZRIEDCBVEGEU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |