C22H26N2S — CID 15229270
3-(1-benzylpiperidin-4-yl)sulfanyl-2,5-dimethyl-1H-indole (PubChem CID 15229270) has the molecular formula C22H26N2S and a molecular weight of 350.53 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)sulfanyl-2,5-dimethyl-1H-indole.
| Compound Name | 3-(1-benzylpiperidin-4-yl)sulfanyl-2,5-dimethyl-1H-indole |
|---|---|
| PubChem CID | 15229270 |
| Molecular Formula | C22H26N2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)sulfanyl-2,5-dimethyl-1H-indole |
| SMILES | Cc1ccc2[nH]c(C)c(SC3CCN(Cc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C22H26N2S/c1-16-8-9-21-20(14-16)22(17(2)23-21)25-19-10-12-24(13-11-19)15-18-6-4-3-5-7-18/h3-9,14,19,23H,10-13,15H2,1-2H3 |
| InChIKey | PXGSPXSHLPMCRX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |