C22H27N3O — CID 92736497
(1R)-1-(2,5-dimethyl-1H-indol-3-yl)-2-(4-phenylpiperazin-1-yl)ethanol (PubChem CID 92736497) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is (1R)-1-(2,5-dimethyl-1H-indol-3-yl)-2-(4-phenylpiperazin-1-yl)ethanol.
| Compound Name | (1R)-1-(2,5-dimethyl-1H-indol-3-yl)-2-(4-phenylpiperazin-1-yl)ethanol |
|---|---|
| PubChem CID | 92736497 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (1R)-1-(2,5-dimethyl-1H-indol-3-yl)-2-(4-phenylpiperazin-1-yl)ethanol |
| SMILES | Cc1ccc2[nH]c(C)c([C@@H](O)CN3CCN(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C22H27N3O/c1-16-8-9-20-19(14-16)22(17(2)23-20)21(26)15-24-10-12-25(13-11-24)18-6-4-3-5-7-18/h3-9,14,21,23,26H,10-13,15H2,1-2H3/t21-/m0/s1 |
| InChIKey | POMXRVQCPSRLPL-NRFANRHFSA-N |
| XLogP | 3.64 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|