C23H19FN2O3S — CID 25215774
N-[(E)-[5-fluoro-2-[2-(4-methoxyphenyl)ethynyl]phenyl]methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 25215774) has the molecular formula C23H19FN2O3S and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[(E)-[5-fluoro-2-[2-(4-methoxyphenyl)ethynyl]phenyl]methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[5-fluoro-2-[2-(4-methoxyphenyl)ethynyl]phenyl]methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25215774 |
| Molecular Formula | C23H19FN2O3S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[(E)-[5-fluoro-2-[2-(4-methoxyphenyl)ethynyl]phenyl]methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(C#Cc2ccc(F)cc2/C=N/NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H19FN2O3S/c1-17-3-13-23(14-4-17)30(27,28)26-25-16-20-15-21(24)10-9-19(20)8-5-18-6-11-22(29-2)12-7-18/h3-4,6-7,9-16,26H,1-2H3/b25-16+ |
| InChIKey | AVLYVRBUEWAGEI-PCLIKHOPSA-N |
| XLogP | 3.85 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|