C11H21O3P — CID 25216260
ethoxy(2-methylocta-2,3-dien-4-yl)phosphinic acid (PubChem CID 25216260) has the molecular formula C11H21O3P and a molecular weight of 232.26 g/mol. Its IUPAC name is ethoxy(2-methylocta-2,3-dien-4-yl)phosphinic acid.
| Compound Name | ethoxy(2-methylocta-2,3-dien-4-yl)phosphinic acid |
|---|---|
| PubChem CID | 25216260 |
| Molecular Formula | C11H21O3P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | ethoxy(2-methylocta-2,3-dien-4-yl)phosphinic acid |
| SMILES | CCCCC(=C=C(C)C)P(=O)(O)OCC |
| InChI | InChI=1S/C11H21O3P/c1-5-7-8-11(9-10(3)4)15(12,13)14-6-2/h5-8H2,1-4H3,(H,12,13) |
| InChIKey | WDYJYWLDDCVMLR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|