C23H14F4N2O4S — CID 25216785
14-fluoro-15-methyl-11-[(2,3,6-trifluoro-5-methylsulfonylphenyl)methyl]-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one (PubChem CID 25216785) has the molecular formula C23H14F4N2O4S and a molecular weight of 490.43 g/mol. Its IUPAC name is 14-fluoro-15-methyl-11-[(2,3,6-trifluoro-5-methylsulfonylphenyl)methyl]-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one.
| Compound Name | 14-fluoro-15-methyl-11-[(2,3,6-trifluoro-5-methylsulfonylphenyl)methyl]-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one |
|---|---|
| PubChem CID | 25216785 |
| Molecular Formula | C23H14F4N2O4S |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 14-fluoro-15-methyl-11-[(2,3,6-trifluoro-5-methylsulfonylphenyl)methyl]-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one |
| SMILES | Cc1cc2c3c4cccnc4oc(=O)c3n(Cc3c(F)c(F)cc(S(C)(=O)=O)c3F)c2cc1F |
| InChI | InChI=1S/C23H14F4N2O4S/c1-10-6-12-16(7-14(10)24)29(21-18(12)11-4-3-5-28-22(11)33-23(21)30)9-13-19(26)15(25)8-17(20(13)27)34(2,31)32/h3-8H,9H2,1-2H3 |
| InChIKey | WZFAWXJQEYQQJQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 82.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|