C21H22N2O4 — CID 25221964
diethyl 2-cyano-6-pyrrolidin-1-ylazulene-1,3-dicarboxylate (PubChem CID 25221964) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is diethyl 2-cyano-6-pyrrolidin-1-ylazulene-1,3-dicarboxylate.
| Compound Name | diethyl 2-cyano-6-pyrrolidin-1-ylazulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 25221964 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | diethyl 2-cyano-6-pyrrolidin-1-ylazulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccc(N3CCCC3)ccc-2c(C(=O)OCC)c1C#N |
| InChI | InChI=1S/C21H22N2O4/c1-3-26-20(24)18-15-9-7-14(23-11-5-6-12-23)8-10-16(15)19(17(18)13-22)21(25)27-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | FBFZRMLKFHVPLD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |