C25H34N6O5 — CID 25222686
methyl 4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]-3-methoxybenzoate (PubChem CID 25222686) has the molecular formula C25H34N6O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is methyl 4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]-3-methoxybenzoate.
| Compound Name | methyl 4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 25222686 |
| Molecular Formula | C25H34N6O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | methyl 4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]-3-methoxybenzoate |
| SMILES | CCCCOc1nc(NCCN2CCOCC2)c2ncn(Cc3ccc(C(=O)OC)cc3OC)c2n1 |
| InChI | InChI=1S/C25H34N6O5/c1-4-5-12-36-25-28-22(26-8-9-30-10-13-35-14-11-30)21-23(29-25)31(17-27-21)16-19-7-6-18(24(32)34-3)15-20(19)33-2/h6-7,15,17H,4-5,8-14,16H2,1-3H3,(H,26,28,29) |
| InChIKey | FYSYRNFCIAMRJC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|