C12H21NO — CID 25222940
(5R,6R)-5-methyl-8-azaspiro[5.6]dodecan-7-one (PubChem CID 25222940) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (5R,6R)-5-methyl-8-azaspiro[5.6]dodecan-7-one.
| Compound Name | (5R,6R)-5-methyl-8-azaspiro[5.6]dodecan-7-one |
|---|---|
| PubChem CID | 25222940 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (5R,6R)-5-methyl-8-azaspiro[5.6]dodecan-7-one |
| SMILES | C[C@@H]1CCCC[C@@]12CCCCNC2=O |
| InChI | InChI=1S/C12H21NO/c1-10-6-2-3-7-12(10)8-4-5-9-13-11(12)14/h10H,2-9H2,1H3,(H,13,14)/t10-,12-/m1/s1 |
| InChIKey | FUQNCXJKOBJGNU-ZYHUDNBSSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |