C20H22F2N2O2 — CID 25223284
benzyl N-[4-(3,3-difluoro-1-methylpiperidin-4-yl)phenyl]carbamate (PubChem CID 25223284) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is benzyl N-[4-(3,3-difluoro-1-methylpiperidin-4-yl)phenyl]carbamate.
| Compound Name | benzyl N-[4-(3,3-difluoro-1-methylpiperidin-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 25223284 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | benzyl N-[4-(3,3-difluoro-1-methylpiperidin-4-yl)phenyl]carbamate |
| SMILES | CN1CCC(c2ccc(NC(=O)OCc3ccccc3)cc2)C(F)(F)C1 |
| InChI | InChI=1S/C20H22F2N2O2/c1-24-12-11-18(20(21,22)14-24)16-7-9-17(10-8-16)23-19(25)26-13-15-5-3-2-4-6-15/h2-10,18H,11-14H2,1H3,(H,23,25) |
| InChIKey | WDTUWWBSGOEMHQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |