C11H16O5 — CID 25223637
ethyl (2R)-2-hydroxy-3-methyl-2-[(2R)-5-oxo-2H-furan-2-yl]butanoate (PubChem CID 25223637) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is ethyl (2R)-2-hydroxy-3-methyl-2-[(2R)-5-oxo-2H-furan-2-yl]butanoate.
| Compound Name | ethyl (2R)-2-hydroxy-3-methyl-2-[(2R)-5-oxo-2H-furan-2-yl]butanoate |
|---|---|
| PubChem CID | 25223637 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | ethyl (2R)-2-hydroxy-3-methyl-2-[(2R)-5-oxo-2H-furan-2-yl]butanoate |
| SMILES | CCOC(=O)[C@@](O)(C(C)C)[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C11H16O5/c1-4-15-10(13)11(14,7(2)3)8-5-6-9(12)16-8/h5-8,14H,4H2,1-3H3/t8-,11-/m1/s1 |
| InChIKey | WPKJVWDHTZYPBQ-LDYMZIIASA-N |
| XLogP | 0.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |