C11H14O2 — CID 25224362
(5S,5aR)-5-methyl-1,3,5,5a,6,8-hexahydrofuro[3,4-e][2]benzofuran (PubChem CID 25224362) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (5S,5aR)-5-methyl-1,3,5,5a,6,8-hexahydrofuro[3,4-e][2]benzofuran.
| Compound Name | (5S,5aR)-5-methyl-1,3,5,5a,6,8-hexahydrofuro[3,4-e][2]benzofuran |
|---|---|
| PubChem CID | 25224362 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (5S,5aR)-5-methyl-1,3,5,5a,6,8-hexahydrofuro[3,4-e][2]benzofuran |
| SMILES | C[C@H]1C=C2COCC2=C2COC[C@@H]21 |
| InChI | InChI=1S/C11H14O2/c1-7-2-8-3-12-5-10(8)11-6-13-4-9(7)11/h2,7,9H,3-6H2,1H3/t7-,9+/m0/s1 |
| InChIKey | XAQSHMHPGVKTCU-IONNQARKSA-N |
| XLogP | 1.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |