C25H18F4N4O6S — CID 25224682
N-cyclopropylsulfonyl-1-[(2-fluoro-5-nitrophenyl)methyl]-3-(2-oxo-1H-pyridin-3-yl)-5-(trifluoromethyl)indole-2-carboxamide (PubChem CID 25224682) has the molecular formula C25H18F4N4O6S and a molecular weight of 578.50 g/mol. Its IUPAC name is N-cyclopropylsulfonyl-1-[(2-fluoro-5-nitrophenyl)methyl]-3-(2-oxo-1H-pyridin-3-yl)-5-(trifluoromethyl)indole-2-carboxamide.
| Compound Name | N-cyclopropylsulfonyl-1-[(2-fluoro-5-nitrophenyl)methyl]-3-(2-oxo-1H-pyridin-3-yl)-5-(trifluoromethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 25224682 |
| Molecular Formula | C25H18F4N4O6S |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | N-cyclopropylsulfonyl-1-[(2-fluoro-5-nitrophenyl)methyl]-3-(2-oxo-1H-pyridin-3-yl)-5-(trifluoromethyl)indole-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)C1CC1)c1c(-c2ccc[nH]c2=O)c2cc(C(F)(F)F)ccc2n1Cc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C25H18F4N4O6S/c26-19-7-4-15(33(36)37)10-13(19)12-32-20-8-3-14(25(27,28)29)11-18(20)21(17-2-1-9-30-23(17)34)22(32)24(35)31-40(38,39)16-5-6-16/h1-4,7-11,16H,5-6,12H2,(H,30,34)(H,31,35) |
| InChIKey | PMWKZNQZCPJCDA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 144.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|