C25H21FN4O6S — CID 25226549
N-cyclopropylsulfonyl-1-[(2-fluoro-5-nitrophenyl)methyl]-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxamide (PubChem CID 25226549) has the molecular formula C25H21FN4O6S and a molecular weight of 524.53 g/mol. Its IUPAC name is N-cyclopropylsulfonyl-1-[(2-fluoro-5-nitrophenyl)methyl]-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxamide.
| Compound Name | N-cyclopropylsulfonyl-1-[(2-fluoro-5-nitrophenyl)methyl]-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 25226549 |
| Molecular Formula | C25H21FN4O6S |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | N-cyclopropylsulfonyl-1-[(2-fluoro-5-nitrophenyl)methyl]-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxamide |
| SMILES | Cc1ccc2c(c1)c(-c1ccc[nH]c1=O)c(C(=O)NS(=O)(=O)C1CC1)n2Cc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C25H21FN4O6S/c1-14-4-9-21-19(11-14)22(18-3-2-10-27-24(18)31)23(25(32)28-37(35,36)17-6-7-17)29(21)13-15-12-16(30(33)34)5-8-20(15)26/h2-5,8-12,17H,6-7,13H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | MGFUXFKWOHITDS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 144.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|