C24H22N4O3S — CID 2522571
N-(2-methoxyphenyl)-4-[[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzamide (PubChem CID 2522571) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-[[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzamide.
| Compound Name | N-(2-methoxyphenyl)-4-[[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2522571 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-(2-methoxyphenyl)-4-[[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)CSc2nc3ccc(C)cc3[nH]2)cc1 |
| InChI | InChI=1S/C24H22N4O3S/c1-15-7-12-18-20(13-15)28-24(27-18)32-14-22(29)25-17-10-8-16(9-11-17)23(30)26-19-5-3-4-6-21(19)31-2/h3-13H,14H2,1-2H3,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | VWSRRLJTFFWTOQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |