C12H18O8 — CID 25227959
dimethyl (4R,5R)-4-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 25227959) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is dimethyl (4R,5R)-4-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dimethyl (4R,5R)-4-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 25227959 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | dimethyl (4R,5R)-4-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1OC(C)(C)O[C@@]1(COC(C)=O)C(=O)OC |
| InChI | InChI=1S/C12H18O8/c1-7(13)18-6-12(10(15)17-5)8(9(14)16-4)19-11(2,3)20-12/h8H,6H2,1-5H3/t8-,12+/m0/s1 |
| InChIKey | HZSSLUGQWLHUTO-QPUJVOFHSA-N |
| XLogP | -0.21 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|