C20H28N2O4 — CID 25228364
tert-butyl (7S,8aS)-8,8-dimethyl-6-oxo-7-phenoxy-3,4,7,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine-1-carboxylate (PubChem CID 25228364) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is tert-butyl (7S,8aS)-8,8-dimethyl-6-oxo-7-phenoxy-3,4,7,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | tert-butyl (7S,8aS)-8,8-dimethyl-6-oxo-7-phenoxy-3,4,7,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 25228364 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | tert-butyl (7S,8aS)-8,8-dimethyl-6-oxo-7-phenoxy-3,4,7,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN2C(=O)[C@@H](Oc3ccccc3)C(C)(C)[C@H]12 |
| InChI | InChI=1S/C20H28N2O4/c1-19(2,3)26-18(24)22-13-9-12-21-16(23)15(20(4,5)17(21)22)25-14-10-7-6-8-11-14/h6-8,10-11,15,17H,9,12-13H2,1-5H3/t15-,17+/m1/s1 |
| InChIKey | NRWPSSRQWVOULO-WBVHZDCISA-N |
| XLogP | 3.27 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |