C25H26BN3O2 — CID 25229346
7-benzyl-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine (PubChem CID 25229346) has the molecular formula C25H26BN3O2 and a molecular weight of 411.31 g/mol. Its IUPAC name is 7-benzyl-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-benzyl-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 25229346 |
| Molecular Formula | C25H26BN3O2 |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 7-benzyl-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
| SMILES | CC1(C)OB(c2cc3c(-c4ccccc4)ncnc3n2Cc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C25H26BN3O2/c1-24(2)25(3,4)31-26(30-24)21-15-20-22(19-13-9-6-10-14-19)27-17-28-23(20)29(21)16-18-11-7-5-8-12-18/h5-15,17H,16H2,1-4H3 |
| InChIKey | RITDLDZEICYHOG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|