C22H27NO4 — CID 25229428
methyl 4-[(3R,7aR,11aR)-5-oxo-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-8-yl]butanoate (PubChem CID 25229428) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is methyl 4-[(3R,7aR,11aR)-5-oxo-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-8-yl]butanoate.
| Compound Name | methyl 4-[(3R,7aR,11aR)-5-oxo-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-8-yl]butanoate |
|---|---|
| PubChem CID | 25229428 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | methyl 4-[(3R,7aR,11aR)-5-oxo-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-8-yl]butanoate |
| SMILES | COC(=O)CCCC1=CCC[C@]23OC[C@@H](c4ccccc4)N2C(=O)CC[C@H]13 |
| InChI | InChI=1S/C22H27NO4/c1-26-21(25)11-5-9-16-10-6-14-22-18(16)12-13-20(24)23(22)19(15-27-22)17-7-3-2-4-8-17/h2-4,7-8,10,18-19H,5-6,9,11-15H2,1H3/t18-,19+,22-/m1/s1 |
| InChIKey | XFDMQVCYQFGEJX-XQBPLPMBSA-N |
| XLogP | 3.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|